C24H36N2O2 — CID 56673180
(Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)octadec-9-en-1-one (PubChem CID 56673180) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)octadec-9-en-1-one.
| Compound Name | (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 56673180 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)c1nc2cccnc2o1 |
| InChI | InChI=1S/C24H36N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(27)24-26-21-18-17-20-25-23(21)28-24/h9-10,17-18,20H,2-8,11-16,19H2,1H3/b10-9- |
| InChIKey | ZWVJENCSDSZVOS-KTKRTIGZSA-N |
| XLogP | 7.44 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|