C14H15F4N3 — CID 141100460
1-(1-ethylpiperidin-3-yl)-4,5,6,7-tetrafluorobenzimidazole (PubChem CID 141100460) has the molecular formula C14H15F4N3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-4,5,6,7-tetrafluorobenzimidazole.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-4,5,6,7-tetrafluorobenzimidazole |
|---|---|
| PubChem CID | 141100460 |
| Molecular Formula | C14H15F4N3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-4,5,6,7-tetrafluorobenzimidazole |
| SMILES | CCN1CCCC(n2cnc3c(F)c(F)c(F)c(F)c32)C1 |
| InChI | InChI=1S/C14H15F4N3/c1-2-20-5-3-4-8(6-20)21-7-19-13-11(17)9(15)10(16)12(18)14(13)21/h7-8H,2-6H2,1H3 |
| InChIKey | REODPFPZTMYKDY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|