C9H9N3O4 — CID 141101165
2-(2-nitroimidazolidin-1-yl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol (PubChem CID 141101165) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-(2-nitroimidazolidin-1-yl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol.
| Compound Name | 2-(2-nitroimidazolidin-1-yl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
|---|---|
| PubChem CID | 141101165 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-(2-nitroimidazolidin-1-yl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
| SMILES | O=[N+]([O-])C1NCCN1c1c(O)ccc2c1O2 |
| InChI | InChI=1S/C9H9N3O4/c13-5-1-2-6-8(16-6)7(5)11-4-3-10-9(11)12(14)15/h1-2,9-10,13H,3-4H2 |
| InChIKey | UUHIZBQXBUODBW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|