C7H9ClN2O3S — CID 66525441
2-(5-nitrofuran-2-yl)-1,3-thiazolidine;hydrochloride (PubChem CID 66525441) has the molecular formula C7H9ClN2O3S and a molecular weight of 236.68 g/mol. Its IUPAC name is 2-(5-nitrofuran-2-yl)-1,3-thiazolidine;hydrochloride.
| Compound Name | 2-(5-nitrofuran-2-yl)-1,3-thiazolidine;hydrochloride |
|---|---|
| PubChem CID | 66525441 |
| Molecular Formula | C7H9ClN2O3S |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 2-(5-nitrofuran-2-yl)-1,3-thiazolidine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(C2NCCS2)o1 |
| InChI | InChI=1S/C7H8N2O3S.ClH/c10-9(11)6-2-1-5(12-6)7-8-3-4-13-7;/h1-2,7-8H,3-4H2;1H |
| InChIKey | JXJQRIRPQFVBRG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|