C11H12N2S — CID 3043139
2-(1H-indol-3-yl)-1,3-thiazolidine (PubChem CID 3043139) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1,3-thiazolidine.
| Compound Name | 2-(1H-indol-3-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 3043139 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-(1H-indol-3-yl)-1,3-thiazolidine |
| SMILES | c1ccc2c(C3NCCS3)c[nH]c2c1 |
| InChI | InChI=1S/C11H12N2S/c1-2-4-10-8(3-1)9(7-13-10)11-12-5-6-14-11/h1-4,7,11-13H,5-6H2 |
| InChIKey | BNKKCGMLJYAMBT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |