About hexyl(dipentyl)sulfanium
hexyl(dipentyl)sulfanium (PubChem CID 141102633) has the molecular formula C16H35S+
and a molecular weight of 259.52 g/mol. Its IUPAC name is hexyl(dipentyl)sulfanium.
Molecular Properties
| Compound Name | hexyl(dipentyl)sulfanium |
| PubChem CID | 141102633 |
| Molecular Formula | C16H35S+ |
| Molecular Weight | 259.52 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | hexyl(dipentyl)sulfanium |
| SMILES | CCCCCC[S+](CCCCC)CCCCC |
| InChI | InChI=1S/C16H35S/c1-4-7-10-13-16-17(14-11-8-5-2)15-12-9-6-3/h4-16H2,1-3H3/q+1 |
| InChIKey | AGXDFNAZGQIZOA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze hexyl(dipentyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl(dipentyl)sulfanium?
The IUPAC name of hexyl(dipentyl)sulfanium (CID 141102633) is hexyl(dipentyl)sulfanium.
What is the SMILES notation for hexyl(dipentyl)sulfanium?
The canonical SMILES for hexyl(dipentyl)sulfanium is CCCCCC[S+](CCCCC)CCCCC.
What is the InChIKey of hexyl(dipentyl)sulfanium?
The InChIKey is AGXDFNAZGQIZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35S/c1-4-7-10-13-16-17(14-11-8-5-2)15-12-9-6-3/h4-16H2,1-3H3/q+1.
What are the key properties of hexyl(dipentyl)sulfanium?
hexyl(dipentyl)sulfanium has a molecular weight of 259.52 g/mol, XLogP of 5.57, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl(dipentyl)sulfanium is sourced from PubChem (CID 141102633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).