About trioctylsulfanium
trioctylsulfanium (PubChem CID 21452185) has the molecular formula C24H51S+
and a molecular weight of 371.74 g/mol. Its IUPAC name is trioctylsulfanium.
Molecular Properties
| Compound Name | trioctylsulfanium |
| PubChem CID | 21452185 |
| Molecular Formula | C24H51S+ |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.37 |
| IUPAC Name | trioctylsulfanium |
| SMILES | CCCCCCCC[S+](CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C24H51S/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3/q+1 |
| InChIKey | FCGOWIKMBOOINZ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze trioctylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trioctylsulfanium?
The IUPAC name of trioctylsulfanium (CID 21452185) is trioctylsulfanium.
What is the SMILES notation for trioctylsulfanium?
The canonical SMILES for trioctylsulfanium is CCCCCCCC[S+](CCCCCCCC)CCCCCCCC.
What is the InChIKey of trioctylsulfanium?
The InChIKey is FCGOWIKMBOOINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51S/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3/q+1.
What are the key properties of trioctylsulfanium?
trioctylsulfanium has a molecular weight of 371.74 g/mol, XLogP of 8.69, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trioctylsulfanium is sourced from PubChem (CID 21452185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).