About fluoroform;trioctylsulfanium
fluoroform;trioctylsulfanium (PubChem CID 162048426) has the molecular formula C25H52F3S+
and a molecular weight of 441.75 g/mol. Its IUPAC name is fluoroform;trioctylsulfanium.
Molecular Properties
| Compound Name | fluoroform;trioctylsulfanium |
| PubChem CID | 162048426 |
| Molecular Formula | C25H52F3S+ |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.37 |
| IUPAC Name | fluoroform;trioctylsulfanium |
| SMILES | CCCCCCCC[S+](CCCCCCCC)CCCCCCCC.FC(F)F |
| InChI | InChI=1S/C24H51S.CHF3/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;2-1(3)4/h4-24H2,1-3H3;1H/q+1; |
| InChIKey | YYFLOFAKLLKEBO-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;trioctylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;trioctylsulfanium?
The IUPAC name of fluoroform;trioctylsulfanium (CID 162048426) is fluoroform;trioctylsulfanium.
What is the SMILES notation for fluoroform;trioctylsulfanium?
The canonical SMILES for fluoroform;trioctylsulfanium is CCCCCCCC[S+](CCCCCCCC)CCCCCCCC.FC(F)F.
What is the InChIKey of fluoroform;trioctylsulfanium?
The InChIKey is YYFLOFAKLLKEBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51S.CHF3/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;2-1(3)4/h4-24H2,1-3H3;1H/q+1;.
What are the key properties of fluoroform;trioctylsulfanium?
fluoroform;trioctylsulfanium has a molecular weight of 441.75 g/mol, XLogP of 9.86, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;trioctylsulfanium is sourced from PubChem (CID 162048426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).