About 2-dioctylsulfonioacetate
2-dioctylsulfonioacetate (PubChem CID 140922654) has the molecular formula C18H36O2S
and a molecular weight of 316.55 g/mol. Its IUPAC name is 2-dioctylsulfonioacetate.
Molecular Properties
| Compound Name | 2-dioctylsulfonioacetate |
| PubChem CID | 140922654 |
| Molecular Formula | C18H36O2S |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-dioctylsulfonioacetate |
| SMILES | CCCCCCCC[S+](CCCCCCCC)CC(=O)[O-] |
| InChI | InChI=1S/C18H36O2S/c1-3-5-7-9-11-13-15-21(17-18(19)20)16-14-12-10-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | DYKYXSJXFJZBLD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-dioctylsulfonioacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dioctylsulfonioacetate?
The IUPAC name of 2-dioctylsulfonioacetate (CID 140922654) is 2-dioctylsulfonioacetate.
What is the SMILES notation for 2-dioctylsulfonioacetate?
The canonical SMILES for 2-dioctylsulfonioacetate is CCCCCCCC[S+](CCCCCCCC)CC(=O)[O-].
What is the InChIKey of 2-dioctylsulfonioacetate?
The InChIKey is DYKYXSJXFJZBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2S/c1-3-5-7-9-11-13-15-21(17-18(19)20)16-14-12-10-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of 2-dioctylsulfonioacetate?
2-dioctylsulfonioacetate has a molecular weight of 316.55 g/mol, XLogP of 4.08, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dioctylsulfonioacetate is sourced from PubChem (CID 140922654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).