About bis(2-dibutylsulfonioacetate);diethyltin(2+)
bis(2-dibutylsulfonioacetate);diethyltin(2+) (PubChem CID 172841629) has the molecular formula C24H50O4S2Sn+2
and a molecular weight of 585.51 g/mol. Its IUPAC name is bis(2-dibutylsulfonioacetate);diethyltin(2+).
Molecular Properties
| Compound Name | bis(2-dibutylsulfonioacetate);diethyltin(2+) |
| PubChem CID | 172841629 |
| Molecular Formula | C24H50O4S2Sn+2 |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | bis(2-dibutylsulfonioacetate);diethyltin(2+) |
| SMILES | CCCC[S+](CCCC)CC(=O)[O-].CCCC[S+](CCCC)CC(=O)[O-].CC[Sn+2]CC |
| InChI | InChI=1S/2C10H20O2S.2C2H5.Sn/c2*1-3-5-7-13(8-6-4-2)9-10(11)12;2*1-2;/h2*3-9H2,1-2H3;2*1H2,2H3;/q;;;;+2 |
| InChIKey | WWFRFPFJHREOEB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze bis(2-dibutylsulfonioacetate);diethyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-dibutylsulfonioacetate);diethyltin(2+)?
The IUPAC name of bis(2-dibutylsulfonioacetate);diethyltin(2+) (CID 172841629) is bis(2-dibutylsulfonioacetate);diethyltin(2+).
What is the SMILES notation for bis(2-dibutylsulfonioacetate);diethyltin(2+)?
The canonical SMILES for bis(2-dibutylsulfonioacetate);diethyltin(2+) is CCCC[S+](CCCC)CC(=O)[O-].CCCC[S+](CCCC)CC(=O)[O-].CC[Sn+2]CC.
What is the InChIKey of bis(2-dibutylsulfonioacetate);diethyltin(2+)?
The InChIKey is WWFRFPFJHREOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O2S.2C2H5.Sn/c2*1-3-5-7-13(8-6-4-2)9-10(11)12;2*1-2;/h2*3-9H2,1-2H3;2*1H2,2H3;/q;;;;+2.
What are the key properties of bis(2-dibutylsulfonioacetate);diethyltin(2+)?
bis(2-dibutylsulfonioacetate);diethyltin(2+) has a molecular weight of 585.51 g/mol, XLogP of 3.48, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-dibutylsulfonioacetate);diethyltin(2+) is sourced from PubChem (CID 172841629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).