C24H48O4S4Sn — CID 21295034
bis(2,2-bis(butylsulfanyl)acetate);diethyltin(2+) (PubChem CID 21295034) has the molecular formula C24H48O4S4Sn and a molecular weight of 647.62 g/mol. Its IUPAC name is bis(2,2-bis(butylsulfanyl)acetate);diethyltin(2+).
| Compound Name | bis(2,2-bis(butylsulfanyl)acetate);diethyltin(2+) |
|---|---|
| PubChem CID | 21295034 |
| Molecular Formula | C24H48O4S4Sn |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | bis(2,2-bis(butylsulfanyl)acetate);diethyltin(2+) |
| SMILES | CCCCSC(SCCCC)C(=O)[O-].CCCCSC(SCCCC)C(=O)[O-].CC[Sn+2]CC |
| InChI | InChI=1S/2C10H20O2S2.2C2H5.Sn/c2*1-3-5-7-13-10(9(11)12)14-8-6-4-2;2*1-2;/h2*10H,3-8H2,1-2H3,(H,11,12);2*1H2,2H3;/q;;;;+2/p-2 |
| InChIKey | MZBXCSAHLMRPQJ-UHFFFAOYSA-L |
| XLogP | 5.82 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|