About 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate
1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate (PubChem CID 141102946) has the molecular formula C43H82O7
and a molecular weight of 711.12 g/mol. Its IUPAC name is 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate.
Molecular Properties
| Compound Name | 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate |
| PubChem CID | 141102946 |
| Molecular Formula | C43H82O7 |
| Molecular Weight | 711.12 g/mol |
| Exact Mass | 710.61 |
| IUPAC Name | 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(CCCC(C)CCCC(C)CCOC(=O)OCCCCCCCC)C(=O)OCCCCCCCCC |
| InChI | InChI=1S/C43H82O7/c1-6-9-12-15-18-20-23-25-35-48-42(45)40(41(44)47-34-24-22-19-16-13-10-7-2)32-28-31-38(4)29-27-30-39(5)33-37-50-43(46)49-36-26-21-17-14-11-8-3/h38-40H,6-37H2,1-5H3 |
| InChIKey | ZXSMQOBHKYHQBJ-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 711.12 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate?
The IUPAC name of 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate (CID 141102946) is 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate.
What is the SMILES notation for 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate?
The canonical SMILES for 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate is CCCCCCCCCCOC(=O)C(CCCC(C)CCCC(C)CCOC(=O)OCCCCCCCC)C(=O)OCCCCCCCCC.
What is the InChIKey of 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate?
The InChIKey is ZXSMQOBHKYHQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H82O7/c1-6-9-12-15-18-20-23-25-35-48-42(45)40(41(44)47-34-24-22-19-16-13-10-7-2)32-28-31-38(4)29-27-30-39(5)33-37-50-43(46)49-36-26-21-17-14-11-8-3/h38-40H,6-37H2,1-5H3.
What are the key properties of 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate?
1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate has a molecular weight of 711.12 g/mol, XLogP of 13.10, 37 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-decyl 3-O-nonyl 2-(4,8-dimethyl-10-octoxycarbonyloxydecyl)propanedioate is sourced from PubChem (CID 141102946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).