C11H11F4N5O2 — CID 141104139
1-(benzotriazol-1-yl-fluoro-hydroxymethyl)-3,3-dimethyl-1-(trifluoromethyl)urea (PubChem CID 141104139) has the molecular formula C11H11F4N5O2 and a molecular weight of 321.23 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl-fluoro-hydroxymethyl)-3,3-dimethyl-1-(trifluoromethyl)urea.
| Compound Name | 1-(benzotriazol-1-yl-fluoro-hydroxymethyl)-3,3-dimethyl-1-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 141104139 |
| Molecular Formula | C11H11F4N5O2 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(benzotriazol-1-yl-fluoro-hydroxymethyl)-3,3-dimethyl-1-(trifluoromethyl)urea |
| SMILES | CN(C)C(=O)N(C(F)(F)F)C(O)(F)n1nnc2ccccc21 |
| InChI | InChI=1S/C11H11F4N5O2/c1-18(2)9(21)19(10(12,13)14)11(15,22)20-8-6-4-3-5-7(8)16-17-20/h3-6,22H,1-2H3 |
| InChIKey | YSNCNXBNZYNSFY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|