C17H18N8O — CID 3839558
1,3-bis(benzotriazol-1-ylmethyl)-1,3-dimethylurea (PubChem CID 3839558) has the molecular formula C17H18N8O and a molecular weight of 350.39 g/mol. Its IUPAC name is 1,3-bis(benzotriazol-1-ylmethyl)-1,3-dimethylurea.
| Compound Name | 1,3-bis(benzotriazol-1-ylmethyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 3839558 |
| Molecular Formula | C17H18N8O |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1,3-bis(benzotriazol-1-ylmethyl)-1,3-dimethylurea |
| SMILES | CN(Cn1nnc2ccccc21)C(=O)N(C)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C17H18N8O/c1-22(11-24-15-9-5-3-7-13(15)18-20-24)17(26)23(2)12-25-16-10-6-4-8-14(16)19-21-25/h3-10H,11-12H2,1-2H3 |
| InChIKey | KNRQVIAFZRXPNY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |