About N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide
N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide (PubChem CID 4312040) has the molecular formula C16H17N5O
and a molecular weight of 295.35 g/mol. Its IUPAC name is N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide.
Molecular Properties
| Compound Name | N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide |
| PubChem CID | 4312040 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide |
| SMILES | CCC(=O)NN(Cn1nnc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C16H17N5O/c1-2-16(22)18-20(13-8-4-3-5-9-13)12-21-15-11-7-6-10-14(15)17-19-21/h3-11H,2,12H2,1H3,(H,18,22) |
| InChIKey | QHFKRLOSQUWPNN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide?
The IUPAC name of N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide (CID 4312040) is N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide.
What is the SMILES notation for N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide?
The canonical SMILES for N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide is CCC(=O)NN(Cn1nnc2ccccc21)c1ccccc1.
What is the InChIKey of N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide?
The InChIKey is QHFKRLOSQUWPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O/c1-2-16(22)18-20(13-8-4-3-5-9-13)12-21-15-11-7-6-10-14(15)17-19-21/h3-11H,2,12H2,1H3,(H,18,22).
What are the key properties of N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide?
N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide has a molecular weight of 295.35 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzotriazol-1-ylmethyl)-N'-phenylpropanehydrazide is sourced from PubChem (CID 4312040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).