About N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide
N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide (PubChem CID 3839105) has the molecular formula C20H17N5O
and a molecular weight of 343.39 g/mol. Its IUPAC name is N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide |
| PubChem CID | 3839105 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide |
| SMILES | O=C(NN(Cn1nnc2ccccc21)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17N5O/c26-20(16-9-3-1-4-10-16)22-24(17-11-5-2-6-12-17)15-25-19-14-8-7-13-18(19)21-23-25/h1-14H,15H2,(H,22,26) |
| InChIKey | PVFAMAAJMOSEDJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide?
The IUPAC name of N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide (CID 3839105) is N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide.
What is the SMILES notation for N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide?
The canonical SMILES for N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide is O=C(NN(Cn1nnc2ccccc21)c1ccccc1)c1ccccc1.
What is the InChIKey of N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide?
The InChIKey is PVFAMAAJMOSEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5O/c26-20(16-9-3-1-4-10-16)22-24(17-11-5-2-6-12-17)15-25-19-14-8-7-13-18(19)21-23-25/h1-14H,15H2,(H,22,26).
What are the key properties of N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide?
N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide has a molecular weight of 343.39 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzotriazol-1-ylmethyl)-N'-phenylbenzohydrazide is sourced from PubChem (CID 3839105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).