C9H18N2O4 — CID 141104296
N-(dihydroxymethylcarbamoyl)-N-ethyl-2,2-dimethylpropanamide (PubChem CID 141104296) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is N-(dihydroxymethylcarbamoyl)-N-ethyl-2,2-dimethylpropanamide.
| Compound Name | N-(dihydroxymethylcarbamoyl)-N-ethyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 141104296 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N-(dihydroxymethylcarbamoyl)-N-ethyl-2,2-dimethylpropanamide |
| SMILES | CCN(C(=O)NC(O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O4/c1-5-11(6(12)9(2,3)4)7(13)10-8(14)15/h8,14-15H,5H2,1-4H3,(H,10,13) |
| InChIKey | AMDFLDYBRQVRMY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|