C15H16N2O3 — CID 141104329
4-[(2,3-dimethyl-4-propoxyphenyl)methylidene]pyrazole-3,5-dione (PubChem CID 141104329) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-[(2,3-dimethyl-4-propoxyphenyl)methylidene]pyrazole-3,5-dione.
| Compound Name | 4-[(2,3-dimethyl-4-propoxyphenyl)methylidene]pyrazole-3,5-dione |
|---|---|
| PubChem CID | 141104329 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-[(2,3-dimethyl-4-propoxyphenyl)methylidene]pyrazole-3,5-dione |
| SMILES | CCCOc1ccc(C=C2C(=O)N=NC2=O)c(C)c1C |
| InChI | InChI=1S/C15H16N2O3/c1-4-7-20-13-6-5-11(9(2)10(13)3)8-12-14(18)16-17-15(12)19/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | OPIYGSWBSDKNRY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|