C17H22N2O4 — CID 11209346
4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 11209346) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 11209346 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | CCCOc1ccc(C=C2C(=O)NNC2=O)c(OCCC)c1C |
| InChI | InChI=1S/C17H22N2O4/c1-4-8-22-14-7-6-12(15(11(14)3)23-9-5-2)10-13-16(20)18-19-17(13)21/h6-7,10H,4-5,8-9H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | FVPMXCWBBLGSMO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|