C26H30N2O8 — CID 11488880
ethyl (2R,3R)-4-[6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methyl-3-propoxyphenoxy]-2,3-dihydroxybutanoate (PubChem CID 11488880) has the molecular formula C26H30N2O8 and a molecular weight of 498.53 g/mol. Its IUPAC name is ethyl (2R,3R)-4-[6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methyl-3-propoxyphenoxy]-2,3-dihydroxybutanoate.
| Compound Name | ethyl (2R,3R)-4-[6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methyl-3-propoxyphenoxy]-2,3-dihydroxybutanoate |
|---|---|
| PubChem CID | 11488880 |
| Molecular Formula | C26H30N2O8 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | ethyl (2R,3R)-4-[6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methyl-3-propoxyphenoxy]-2,3-dihydroxybutanoate |
| SMILES | CCCOc1ccc(/C=C2\C(=O)NN(c3ccccc3)C2=O)c(OC[C@@H](O)[C@@H](O)C(=O)OCC)c1C |
| InChI | InChI=1S/C26H30N2O8/c1-4-13-35-21-12-11-17(23(16(21)3)36-15-20(29)22(30)26(33)34-5-2)14-19-24(31)27-28(25(19)32)18-9-7-6-8-10-18/h6-12,14,20,22,29-30H,4-5,13,15H2,1-3H3,(H,27,31)/b19-14+/t20-,22-/m1/s1 |
| InChIKey | RGLHYUMFEFVNRC-DLZWTQKGSA-N |
| XLogP | 1.91 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|