C22H27IO3Si — CID 14110585
(4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-(iodomethyl)oxan-2-one (PubChem CID 14110585) has the molecular formula C22H27IO3Si and a molecular weight of 494.45 g/mol. Its IUPAC name is (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-(iodomethyl)oxan-2-one.
| Compound Name | (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-(iodomethyl)oxan-2-one |
|---|---|
| PubChem CID | 14110585 |
| Molecular Formula | C22H27IO3Si |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-(iodomethyl)oxan-2-one |
| SMILES | CC(C)(C)[Si](O[C@H]1CC(=O)O[C@H](CI)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27IO3Si/c1-22(2,3)27(19-10-6-4-7-11-19,20-12-8-5-9-13-20)26-17-14-18(16-23)25-21(24)15-17/h4-13,17-18H,14-16H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | ZTMXITZNBDILPZ-MSOLQXFVSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|