C10H15NO4 — CID 141106101
tert-butyl N-(2-oxo-3,4-dihydropyran-4-yl)carbamate (PubChem CID 141106101) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-3,4-dihydropyran-4-yl)carbamate.
| Compound Name | tert-butyl N-(2-oxo-3,4-dihydropyran-4-yl)carbamate |
|---|---|
| PubChem CID | 141106101 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | tert-butyl N-(2-oxo-3,4-dihydropyran-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C=COC(=O)C1 |
| InChI | InChI=1S/C10H15NO4/c1-10(2,3)15-9(13)11-7-4-5-14-8(12)6-7/h4-5,7H,6H2,1-3H3,(H,11,13) |
| InChIKey | XCFMAXUWFSCEEF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |