C23H33ClN2 — CID 141106143
1-N,1-N,1-N',1-N'-tetraethyl-2-(9H-fluoren-1-yl)ethane-1,1-diamine;hydrochloride (PubChem CID 141106143) has the molecular formula C23H33ClN2 and a molecular weight of 372.98 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetraethyl-2-(9H-fluoren-1-yl)ethane-1,1-diamine;hydrochloride.
| Compound Name | 1-N,1-N,1-N',1-N'-tetraethyl-2-(9H-fluoren-1-yl)ethane-1,1-diamine;hydrochloride |
|---|---|
| PubChem CID | 141106143 |
| Molecular Formula | C23H33ClN2 |
| Molecular Weight | 372.98 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetraethyl-2-(9H-fluoren-1-yl)ethane-1,1-diamine;hydrochloride |
| SMILES | CCN(CC)C(Cc1cccc2c1Cc1ccccc1-2)N(CC)CC.Cl |
| InChI | InChI=1S/C23H32N2.ClH/c1-5-24(6-2)23(25(7-3)8-4)17-19-13-11-15-21-20-14-10-9-12-18(20)16-22(19)21;/h9-15,23H,5-8,16-17H2,1-4H3;1H |
| InChIKey | QFZPYCAPEMTWKD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.98 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|