C17H20N2O — CID 163981163
1-(9H-fluoren-1-ylmethoxy)-1,2,2-trimethylhydrazine (PubChem CID 163981163) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(9H-fluoren-1-ylmethoxy)-1,2,2-trimethylhydrazine.
| Compound Name | 1-(9H-fluoren-1-ylmethoxy)-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 163981163 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(9H-fluoren-1-ylmethoxy)-1,2,2-trimethylhydrazine |
| SMILES | CN(C)N(C)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C17H20N2O/c1-18(2)19(3)20-12-14-8-6-10-16-15-9-5-4-7-13(15)11-17(14)16/h4-10H,11-12H2,1-3H3 |
| InChIKey | SYMIURXBWAZQNG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|