C17H18O2 — CID 176835432
1,8-bis(methoxymethyl)-9H-fluorene (PubChem CID 176835432) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,8-bis(methoxymethyl)-9H-fluorene.
| Compound Name | 1,8-bis(methoxymethyl)-9H-fluorene |
|---|---|
| PubChem CID | 176835432 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1,8-bis(methoxymethyl)-9H-fluorene |
| SMILES | COCc1cccc2c1Cc1c(COC)cccc1-2 |
| InChI | InChI=1S/C17H18O2/c1-18-10-12-5-3-7-14-15-8-4-6-13(11-19-2)17(15)9-16(12)14/h3-8H,9-11H2,1-2H3 |
| InChIKey | SLNAGIOLHNMTDU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |