C12H15BrO — CID 79726783
1-bromo-4-(methoxymethyl)-2-methyl-2,3-dihydro-1H-indene (PubChem CID 79726783) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 1-bromo-4-(methoxymethyl)-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 1-bromo-4-(methoxymethyl)-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 79726783 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-bromo-4-(methoxymethyl)-2-methyl-2,3-dihydro-1H-indene |
| SMILES | COCc1cccc2c1CC(C)C2Br |
| InChI | InChI=1S/C12H15BrO/c1-8-6-11-9(7-14-2)4-3-5-10(11)12(8)13/h3-5,8,12H,6-7H2,1-2H3 |
| InChIKey | XCBHZQDXYDMLDW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|