C18H25NO5S — CID 141107756
(8R,9S,13S,14S,17S)-2-amino-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-4-sulfonic acid (PubChem CID 141107756) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-2-amino-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-4-sulfonic acid.
| Compound Name | (8R,9S,13S,14S,17S)-2-amino-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-4-sulfonic acid |
|---|---|
| PubChem CID | 141107756 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (8R,9S,13S,14S,17S)-2-amino-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-4-sulfonic acid |
| SMILES | C[C@]12CC[C@@H]3c4cc(N)c(O)c(S(=O)(=O)O)c4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C18H25NO5S/c1-18-7-6-9-10(13(18)4-5-15(18)20)2-3-11-12(9)8-14(19)16(21)17(11)25(22,23)24/h8-10,13,15,20-21H,2-7,19H2,1H3,(H,22,23,24)/t9-,10+,13-,15-,18-/m0/s1 |
| InChIKey | RYIFOQWWRPLFHM-ZICKVNAASA-N |
| XLogP | 2.44 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|