C22H22Cl2O2 — CID 101236893
(8R,9S,13S,14S,17S)-2,4-bis(2-chloroethynyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 101236893) has the molecular formula C22H22Cl2O2 and a molecular weight of 389.32 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-2,4-bis(2-chloroethynyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-2,4-bis(2-chloroethynyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 101236893 |
| Molecular Formula | C22H22Cl2O2 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (8R,9S,13S,14S,17S)-2,4-bis(2-chloroethynyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4cc(C#CCl)c(O)c(C#CCl)c4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C22H22Cl2O2/c1-22-9-6-15-16(19(22)4-5-20(22)25)3-2-14-17(8-11-24)21(26)13(7-10-23)12-18(14)15/h12,15-16,19-20,25-26H,2-6,9H2,1H3/t15-,16+,19-,20-,22-/m0/s1 |
| InChIKey | VPBAISHGJCPWTE-OMDNBMQFSA-N |
| XLogP | 4.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|