C25H16Cl2N4O5 — CID 141108335
2-[3-[5,6-dichloro-1-(4-nitrobenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione (PubChem CID 141108335) has the molecular formula C25H16Cl2N4O5 and a molecular weight of 523.33 g/mol. Its IUPAC name is 2-[3-[5,6-dichloro-1-(4-nitrobenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[5,6-dichloro-1-(4-nitrobenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141108335 |
| Molecular Formula | C25H16Cl2N4O5 |
| Molecular Weight | 523.33 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | 2-[3-[5,6-dichloro-1-(4-nitrobenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCc1nc2cc(Cl)c(Cl)cc2n1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H16Cl2N4O5/c26-18-12-20-21(13-19(18)27)30(23(32)14-7-9-15(10-8-14)31(35)36)22(28-20)6-3-11-29-24(33)16-4-1-2-5-17(16)25(29)34/h1-2,4-5,7-10,12-13H,3,6,11H2 |
| InChIKey | ANBNCGNGXQJKPA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|