C18H19ClN4O4 — CID 141108855
4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethoxy]-N-morpholin-4-ylbenzamide (PubChem CID 141108855) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is 4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethoxy]-N-morpholin-4-ylbenzamide.
| Compound Name | 4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethoxy]-N-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 141108855 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethoxy]-N-morpholin-4-ylbenzamide |
| SMILES | O=C(COc1ccc(C(=O)NN2CCOCC2)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H19ClN4O4/c19-14-3-6-16(20-11-14)21-17(24)12-27-15-4-1-13(2-5-15)18(25)22-23-7-9-26-10-8-23/h1-6,11H,7-10,12H2,(H,22,25)(H,20,21,24) |
| InChIKey | HCMRLBZJZWIBMY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |