C15H17F2N3O2 — CID 141109069
2-fluoro-N-[2-fluoro-1-(oxan-2-yl)-3H-pyrazol-3-yl]benzamide (PubChem CID 141109069) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-fluoro-N-[2-fluoro-1-(oxan-2-yl)-3H-pyrazol-3-yl]benzamide.
| Compound Name | 2-fluoro-N-[2-fluoro-1-(oxan-2-yl)-3H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 141109069 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-fluoro-N-[2-fluoro-1-(oxan-2-yl)-3H-pyrazol-3-yl]benzamide |
| SMILES | O=C(NC1C=CN(C2CCCCO2)N1F)c1ccccc1F |
| InChI | InChI=1S/C15H17F2N3O2/c16-12-6-2-1-5-11(12)15(21)18-13-8-9-19(20(13)17)14-7-3-4-10-22-14/h1-2,5-6,8-9,13-14H,3-4,7,10H2,(H,18,21) |
| InChIKey | PLFXFIFXAFLMID-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|