About 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid
3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 141109632) has the molecular formula C19H24N2O4S
and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
| PubChem CID | 141109632 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1sc2ccn(CC(=O)N3CCOCC3)c2c1C1CCCCC1 |
| InChI | InChI=1S/C19H24N2O4S/c22-15(20-8-10-25-11-9-20)12-21-7-6-14-17(21)16(18(26-14)19(23)24)13-4-2-1-3-5-13/h6-7,13H,1-5,8-12H2,(H,23,24) |
| InChIKey | RYUMAOKSOGXFME-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
The IUPAC name of 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid (CID 141109632) is 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid is O=C(O)c1sc2ccn(CC(=O)N3CCOCC3)c2c1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
The InChIKey is RYUMAOKSOGXFME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4S/c22-15(20-8-10-25-11-9-20)12-21-7-6-14-17(21)16(18(26-14)19(23)24)13-4-2-1-3-5-13/h6-7,13H,1-5,8-12H2,(H,23,24).
What are the key properties of 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid has a molecular weight of 376.48 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 141109632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).