C18H15ClN2O2 — CID 141109827
N-(3-chlorophenyl)-6,8-dimethyl-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 141109827) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6,8-dimethyl-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-6,8-dimethyl-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 141109827 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-(3-chlorophenyl)-6,8-dimethyl-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | Cc1cc(C)c2[nH]cc(C(=O)Nc3cccc(Cl)c3)c(=O)c2c1 |
| InChI | InChI=1S/C18H15ClN2O2/c1-10-6-11(2)16-14(7-10)17(22)15(9-20-16)18(23)21-13-5-3-4-12(19)8-13/h3-9H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | DQAZZHBSALCMFH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |