C18H12ClF3N4O2S — CID 56931558
1-(3-chlorophenyl)-3-[[4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]thiourea (PubChem CID 56931558) has the molecular formula C18H12ClF3N4O2S and a molecular weight of 440.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 56931558 |
| Molecular Formula | C18H12ClF3N4O2S |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1cccc(Cl)c1)c1c[nH]c2c(C(F)(F)F)cccc2c1=O |
| InChI | InChI=1S/C18H12ClF3N4O2S/c19-9-3-1-4-10(7-9)24-17(29)26-25-16(28)12-8-23-14-11(15(12)27)5-2-6-13(14)18(20,21)22/h1-8H,(H,23,27)(H,25,28)(H2,24,26,29) |
| InChIKey | IFCAYSMZRPZLLC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|