C18H12F3N3O3S — CID 2445541
1-[(4-oxochromene-3-carbonyl)amino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 2445541) has the molecular formula C18H12F3N3O3S and a molecular weight of 407.37 g/mol. Its IUPAC name is 1-[(4-oxochromene-3-carbonyl)amino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(4-oxochromene-3-carbonyl)amino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2445541 |
| Molecular Formula | C18H12F3N3O3S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 1-[(4-oxochromene-3-carbonyl)amino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1C(F)(F)F)c1coc2ccccc2c1=O |
| InChI | InChI=1S/C18H12F3N3O3S/c19-18(20,21)12-6-2-3-7-13(12)22-17(28)24-23-16(26)11-9-27-14-8-4-1-5-10(14)15(11)25/h1-9H,(H,23,26)(H2,22,24,28) |
| InChIKey | OOWQSEHADHTSHE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|