C17H13ClN2O2S — CID 141109811
N-(3-chlorophenyl)-4-oxo-8-(sulfanylmethyl)-1H-quinoline-3-carboxamide (PubChem CID 141109811) has the molecular formula C17H13ClN2O2S and a molecular weight of 344.82 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-oxo-8-(sulfanylmethyl)-1H-quinoline-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-oxo-8-(sulfanylmethyl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 141109811 |
| Molecular Formula | C17H13ClN2O2S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-(3-chlorophenyl)-4-oxo-8-(sulfanylmethyl)-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1c[nH]c2c(CS)cccc2c1=O |
| InChI | InChI=1S/C17H13ClN2O2S/c18-11-4-2-5-12(7-11)20-17(22)14-8-19-15-10(9-23)3-1-6-13(15)16(14)21/h1-8,23H,9H2,(H,19,21)(H,20,22) |
| InChIKey | UJVFRAXCUAKAMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|