C23H24ClFN2OS — CID 141110706
1-[3-(3-chlorophenyl)propyl]-3-(4-fluorophenyl)-1-(3-thiophen-2-ylpropyl)urea (PubChem CID 141110706) has the molecular formula C23H24ClFN2OS and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-[3-(3-chlorophenyl)propyl]-3-(4-fluorophenyl)-1-(3-thiophen-2-ylpropyl)urea.
| Compound Name | 1-[3-(3-chlorophenyl)propyl]-3-(4-fluorophenyl)-1-(3-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 141110706 |
| Molecular Formula | C23H24ClFN2OS |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[3-(3-chlorophenyl)propyl]-3-(4-fluorophenyl)-1-(3-thiophen-2-ylpropyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)N(CCCc1cccc(Cl)c1)CCCc1cccs1 |
| InChI | InChI=1S/C23H24ClFN2OS/c24-19-7-1-5-18(17-19)6-2-14-27(15-3-8-22-9-4-16-29-22)23(28)26-21-12-10-20(25)11-13-21/h1,4-5,7,9-13,16-17H,2-3,6,8,14-15H2,(H,26,28) |
| InChIKey | MKODBJPITULKJF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |