C20H21NO3 — CID 141111143
(5R)-5-[(E)-3-hydroxy-3-[3-(4-methylphenoxy)phenyl]prop-1-enyl]pyrrolidin-2-one (PubChem CID 141111143) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (5R)-5-[(E)-3-hydroxy-3-[3-(4-methylphenoxy)phenyl]prop-1-enyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(E)-3-hydroxy-3-[3-(4-methylphenoxy)phenyl]prop-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141111143 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (5R)-5-[(E)-3-hydroxy-3-[3-(4-methylphenoxy)phenyl]prop-1-enyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(Oc2cccc(C(O)/C=C/[C@H]3CCC(=O)N3)c2)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-14-5-9-17(10-6-14)24-18-4-2-3-15(13-18)19(22)11-7-16-8-12-20(23)21-16/h2-7,9-11,13,16,19,22H,8,12H2,1H3,(H,21,23)/b11-7+/t16-,19?/m0/s1 |
| InChIKey | CJIUIIJYLZWRII-NYGFAYCJSA-N |
| XLogP | 3.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|