C27H30F3NO5 — CID 91209252
7-[2-[(3R)-3-hydroxy-3-[3-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 91209252) has the molecular formula C27H30F3NO5 and a molecular weight of 505.53 g/mol. Its IUPAC name is 7-[2-[(3R)-3-hydroxy-3-[3-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[2-[(3R)-3-hydroxy-3-[3-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 91209252 |
| Molecular Formula | C27H30F3NO5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 7-[2-[(3R)-3-hydroxy-3-[3-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC1C=C[C@@H](O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H30F3NO5/c28-27(29,30)20-8-6-10-23(18-20)36-22-9-5-7-19(17-22)24(32)14-12-21-13-15-25(33)31(21)16-4-2-1-3-11-26(34)35/h5-10,12,14,17-18,21,24,32H,1-4,11,13,15-16H2,(H,34,35)/t21?,24-/m1/s1 |
| InChIKey | FZNCJENGTXXHBQ-MQNHUJCZSA-N |
| XLogP | 6.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|