C26H35NO5 — CID 91289837
7-[2-[(3R)-3-hydroxy-3-[3-(oxan-4-ylidenemethyl)phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 91289837) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 7-[2-[(3R)-3-hydroxy-3-[3-(oxan-4-ylidenemethyl)phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[2-[(3R)-3-hydroxy-3-[3-(oxan-4-ylidenemethyl)phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 91289837 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 7-[2-[(3R)-3-hydroxy-3-[3-(oxan-4-ylidenemethyl)phenyl]prop-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC1C=C[C@@H](O)c1cccc(C=C2CCOCC2)c1 |
| InChI | InChI=1S/C26H35NO5/c28-24(22-7-5-6-21(19-22)18-20-13-16-32-17-14-20)11-9-23-10-12-25(29)27(23)15-4-2-1-3-8-26(30)31/h5-7,9,11,18-19,23-24,28H,1-4,8,10,12-17H2,(H,30,31)/t23?,24-/m1/s1 |
| InChIKey | QKPFTCDGVSOIJF-XMMISQBUSA-N |
| XLogP | 4.50 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|