C16H32O6Si — CID 141111614
buta-1,3-diene;1-[[dimethoxy(propyl)silyl]oxymethoxy]propyl propanoate (PubChem CID 141111614) has the molecular formula C16H32O6Si and a molecular weight of 348.51 g/mol. Its IUPAC name is buta-1,3-diene;1-[[dimethoxy(propyl)silyl]oxymethoxy]propyl propanoate.
| Compound Name | buta-1,3-diene;1-[[dimethoxy(propyl)silyl]oxymethoxy]propyl propanoate |
|---|---|
| PubChem CID | 141111614 |
| Molecular Formula | C16H32O6Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | buta-1,3-diene;1-[[dimethoxy(propyl)silyl]oxymethoxy]propyl propanoate |
| SMILES | C=CC=C.CCC[Si](OC)(OC)OCOC(CC)OC(=O)CC |
| InChI | InChI=1S/C12H26O6Si.C4H6/c1-6-9-19(14-4,15-5)17-10-16-12(8-3)18-11(13)7-2;1-3-4-2/h12H,6-10H2,1-5H3;3-4H,1-2H2 |
| InChIKey | NVBGAZCSDFFUAO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|