C20H14F3N3O3S — CID 141117056
2-[3-(4-cyanophenyl)-2-(trifluoromethyl)anilino]-6-methylpyridine-4-sulfonic acid (PubChem CID 141117056) has the molecular formula C20H14F3N3O3S and a molecular weight of 433.41 g/mol. Its IUPAC name is 2-[3-(4-cyanophenyl)-2-(trifluoromethyl)anilino]-6-methylpyridine-4-sulfonic acid.
| Compound Name | 2-[3-(4-cyanophenyl)-2-(trifluoromethyl)anilino]-6-methylpyridine-4-sulfonic acid |
|---|---|
| PubChem CID | 141117056 |
| Molecular Formula | C20H14F3N3O3S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[3-(4-cyanophenyl)-2-(trifluoromethyl)anilino]-6-methylpyridine-4-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)cc(Nc2cccc(-c3ccc(C#N)cc3)c2C(F)(F)F)n1 |
| InChI | InChI=1S/C20H14F3N3O3S/c1-12-9-15(30(27,28)29)10-18(25-12)26-17-4-2-3-16(19(17)20(21,22)23)14-7-5-13(11-24)6-8-14/h2-10H,1H3,(H,25,26)(H,27,28,29) |
| InChIKey | CXDRIFLYLWRGIK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|