C21H21NO2S2 — CID 141117906
5-benzyl-N-[(1R,2S,3S)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide (PubChem CID 141117906) has the molecular formula C21H21NO2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 5-benzyl-N-[(1R,2S,3S)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide.
| Compound Name | 5-benzyl-N-[(1R,2S,3S)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 141117906 |
| Molecular Formula | C21H21NO2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 5-benzyl-N-[(1R,2S,3S)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide |
| SMILES | C[C@@H]1[C@@H](NS(=O)(=O)c2ccc(Cc3ccccc3)s2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21NO2S2/c1-15-20(17-10-6-3-7-11-17)21(15)22-26(23,24)19-13-12-18(25-19)14-16-8-4-2-5-9-16/h2-13,15,20-22H,14H2,1H3/t15-,20-,21+/m0/s1 |
| InChIKey | MOMFVIXLKWPDTI-ONGXBYRLSA-N |
| XLogP | 4.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |