C10H20ClO3P — CID 14111810
(E)-1-chloro-4-diethoxyphosphoryl-2,3-dimethylbut-2-ene (PubChem CID 14111810) has the molecular formula C10H20ClO3P and a molecular weight of 254.69 g/mol. Its IUPAC name is (E)-1-chloro-4-diethoxyphosphoryl-2,3-dimethylbut-2-ene.
| Compound Name | (E)-1-chloro-4-diethoxyphosphoryl-2,3-dimethylbut-2-ene |
|---|---|
| PubChem CID | 14111810 |
| Molecular Formula | C10H20ClO3P |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (E)-1-chloro-4-diethoxyphosphoryl-2,3-dimethylbut-2-ene |
| SMILES | CCOP(=O)(C/C(C)=C(\C)CCl)OCC |
| InChI | InChI=1S/C10H20ClO3P/c1-5-13-15(12,14-6-2)8-10(4)9(3)7-11/h5-8H2,1-4H3/b10-9+ |
| InChIKey | CYJZTTHSCRHHHR-MDZDMXLPSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|