About (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane
(4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane (PubChem CID 91313940) has the molecular formula C9H16ClO2P
and a molecular weight of 222.65 g/mol. Its IUPAC name is (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane.
Molecular Properties
| Compound Name | (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane |
| PubChem CID | 91313940 |
| Molecular Formula | C9H16ClO2P |
| Molecular Weight | 222.65 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane |
| SMILES | CCOP(C=C=C(C)CCl)OCC |
| InChI | InChI=1S/C9H16ClO2P/c1-4-11-13(12-5-2)7-6-9(3)8-10/h7H,4-5,8H2,1-3H3 |
| InChIKey | KANFHBUNHQGTCL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane?
The IUPAC name of (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane (CID 91313940) is (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane.
What is the SMILES notation for (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane?
The canonical SMILES for (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane is CCOP(C=C=C(C)CCl)OCC.
What is the InChIKey of (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane?
The InChIKey is KANFHBUNHQGTCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClO2P/c1-4-11-13(12-5-2)7-6-9(3)8-10/h7H,4-5,8H2,1-3H3.
What are the key properties of (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane?
(4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane has a molecular weight of 222.65 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-methylbuta-1,2-dienyl)-diethoxyphosphane is sourced from PubChem (CID 91313940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).