C30H22BrF3N2 — CID 141119957
3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(3-bromophenyl)methyl]aniline (PubChem CID 141119957) has the molecular formula C30H22BrF3N2 and a molecular weight of 547.42 g/mol. Its IUPAC name is 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(3-bromophenyl)methyl]aniline.
| Compound Name | 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(3-bromophenyl)methyl]aniline |
|---|---|
| PubChem CID | 141119957 |
| Molecular Formula | C30H22BrF3N2 |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(3-bromophenyl)methyl]aniline |
| SMILES | FC(F)(F)c1cccc2c(-c3cccc(NCc4cccc(Br)c4)c3)c(Cc3ccccc3)cnc12 |
| InChI | InChI=1S/C30H22BrF3N2/c31-24-11-4-9-21(16-24)18-35-25-12-5-10-22(17-25)28-23(15-20-7-2-1-3-8-20)19-36-29-26(28)13-6-14-27(29)30(32,33)34/h1-14,16-17,19,35H,15,18H2 |
| InChIKey | FYSCJZSMHLSFAU-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |