C20H22N4O2 — CID 141120864
3-[3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[4,3-d]pyrimidin-4-one (PubChem CID 141120864) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-[3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 141120864 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-[3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1c2cnccc2ncn1-c1cccc(OCCCN2CCCC2)c1 |
| InChI | InChI=1S/C20H22N4O2/c25-20-18-14-21-8-7-19(18)22-15-24(20)16-5-3-6-17(13-16)26-12-4-11-23-9-1-2-10-23/h3,5-8,13-15H,1-2,4,9-12H2 |
| InChIKey | OMNKASUGTXSJMI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|