C24H29FN4O3 — CID 87675182
3-[2-(2-fluoroethoxy)-4-(3-piperidin-1-ylpropoxy)phenyl]-2-methylpyrido[3,4-d]pyrimidin-4-one (PubChem CID 87675182) has the molecular formula C24H29FN4O3 and a molecular weight of 440.52 g/mol. Its IUPAC name is 3-[2-(2-fluoroethoxy)-4-(3-piperidin-1-ylpropoxy)phenyl]-2-methylpyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[2-(2-fluoroethoxy)-4-(3-piperidin-1-ylpropoxy)phenyl]-2-methylpyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 87675182 |
| Molecular Formula | C24H29FN4O3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 3-[2-(2-fluoroethoxy)-4-(3-piperidin-1-ylpropoxy)phenyl]-2-methylpyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2cnccc2c(=O)n1-c1ccc(OCCCN2CCCCC2)cc1OCCF |
| InChI | InChI=1S/C24H29FN4O3/c1-18-27-21-17-26-10-8-20(21)24(30)29(18)22-7-6-19(16-23(22)32-15-9-25)31-14-5-13-28-11-3-2-4-12-28/h6-8,10,16-17H,2-5,9,11-15H2,1H3 |
| InChIKey | NHTPMPHSIXXWKC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|