C27H32FN3O5 — CID 86600244
ethyl 3-[2-(2-fluoroethoxy)-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2-methyl-4-oxoquinazoline-6-carboxylate (PubChem CID 86600244) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is ethyl 3-[2-(2-fluoroethoxy)-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2-methyl-4-oxoquinazoline-6-carboxylate.
| Compound Name | ethyl 3-[2-(2-fluoroethoxy)-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2-methyl-4-oxoquinazoline-6-carboxylate |
|---|---|
| PubChem CID | 86600244 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | ethyl 3-[2-(2-fluoroethoxy)-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2-methyl-4-oxoquinazoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(C)n(-c3ccc(OCCCN4CCCC4)cc3OCCF)c(=O)c2c1 |
| InChI | InChI=1S/C27H32FN3O5/c1-3-34-27(33)20-7-9-23-22(17-20)26(32)31(19(2)29-23)24-10-8-21(18-25(24)36-16-11-28)35-15-6-14-30-12-4-5-13-30/h7-10,17-18H,3-6,11-16H2,1-2H3 |
| InChIKey | ZZDAEABFRIGLPU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|