C21H24N4O2 — CID 11617527
3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[2,3-d]pyrimidin-4-one (PubChem CID 11617527) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11617527 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-methyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cn1c(-c2ccc(OCCCN3CCCC3)cc2)nc2ncccc2c1=O |
| InChI | InChI=1S/C21H24N4O2/c1-24-20(23-19-18(21(24)26)6-4-11-22-19)16-7-9-17(10-8-16)27-15-5-14-25-12-2-3-13-25/h4,6-11H,2-3,5,12-15H2,1H3 |
| InChIKey | OUZVUDRPJPJKGP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|